On Target RT_HIV1 0.23364486/CHEMBL3775172
For the given ligand Aspirin, we have found in our database that, being scored 0.23364486, the most similar ligand is CHEMBL3775172. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL3775172 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 00010000 01000800 00000302 40050200 00080000 00004000 80000080 00000402 00000900 00188848 08100000 40009800 04028008 00a00000 00000402 00080008 00000400 02000020 02402000 00000001 01000100 08020a20 01008020 00400014 01200000 80000000 00406000 c0000000 00400002 01020002 e4020000 00000400 |