On Target NS5B_HCV1A 0.41262135/CHEMBL68034
For the given ligand MOLECULE 25, we have found in our database that, being scored 0.41262135, the most similar ligand is CHEMBL68034. Check out the elaboration below.
| MOLECULE 25 (Given Ligand) | CHEMBL68034 (Similar Ligand) |
|---|---|
| COC(=O)NC(C(=O)N1CCCC1c8ncc(c7ccc(c6ccc(c5ccc(c4cnc(C2CCCN2C(=O)C(NC(=O)OC)c3ccccc3)[nH]4)cc5)cc6)cc7)[nH]8)c9ccccc9 | CC(C)COC(=O)N[C@H](C(=O)N1C[C@H](c2ccccc2)C[C@H]1C(=O)N[C@@H](CC(F)F)C(=O)NCCc1c(F)cc(C(=O)O)cc1F)C(C)C |
|
|
|
|
|
|
| 0000a00a 01803800 00100d00 94010e10 00000040 0011001a 01400000 22083049 00800380 000808d0 08218000 4001b800 0b008882 08102000 40020000 801e010c 00028000 06002022 04000018 50000a01 80200000 38278e10 31002001 8350001c 00140001 80080002 00000208 900010e0 0c014304 00e60803 e00468a0 20002600 | 00010000 01403a00 00100102 46050600 00000400 0001c010 00000000 2004000c 00900b80 000928c0 08300000 d001b800 0e008012 00203101 80000000 001e0408 010a0200 02080000 00000810 00000201 00000100 38260e30 01002003 c350001c 00000000 80001082 00000060 90200021 0c000200 0406800b e0004000 00402600 |