On Target PR_SARS 0.4/CHEMBL2441741
For the given ligand MOLECULE 25, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| MOLECULE 25 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| COC(=O)NC(C(=O)N1CCCC1c8ncc(c7ccc(c6ccc(c5ccc(c4cnc(C2CCCN2C(=O)C(NC(=O)OC)c3ccccc3)[nH]4)cc5)cc6)cc7)[nH]8)c9ccccc9 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000a00a 01803800 00100d00 94010e10 00000040 0011001a 01400000 22083049 00800380 000808d0 08218000 4001b800 0b008882 08102000 40020000 801e010c 00028000 06002022 04000018 50000a01 80200000 38278e10 31002001 8350001c 00140001 80080002 00000208 900010e0 0c014304 00e60803 e00468a0 20002600 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |