On Target PR_SARS 0.14197531/CHEMBL2441741
For the given ligand MOLECULE 127, we have found in our database that, being scored 0.14197531, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| MOLECULE 127 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| Nc2ccc1cc(S(=O)(=O)O)ccc1c2/N=N/c7ccc(/C=C/c6ccc(/C=C/c5ccc(/N=N/c3c(N)ccc4cc(S(=O)(=O)O)ccc34)cc5)cc6)cc7 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000002 00800800 40000100 00d10200 00004000 00000000 80000080 00000600 00000300 00080840 00002104 60008000 00000000 08000002 80240352 00000000 00008400 02800000 00000000 00002000 c1000000 18000008 20000002 08482008 00010000 81000000 80402010 40000000 00500000 00060001 06000000 00012020 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |