On Target PLP_SARS 0.2564935/CHEMBL222769
For the given ligand MOLECULE 78, we have found in our database that, being scored 0.2564935, the most similar ligand is CHEMBL222769. Check out the elaboration below.
| MOLECULE 78 (Given Ligand) | CHEMBL222769 (Similar Ligand) |
|---|---|
| O=C(OCC7OC(n5c(=O)n(c1ccccc1)c(=O)c4c(c2ccco2)cc(c3ccccc3)nc45)C(OC(=O)c6ccccc6)C7OC(=O)c8ccccc8)c9ccccc9 | O=C(Oc1cncc(Cl)c1)c1ccc(-c2ccc(Cl)cc2)o1 |
|
|
|
|
|
|
| 0000a002 01e00a00 8008470c 92050700 003c00f0 0200e140 00009e42 00a81440 06506102 d18008f0 0c00182c 60118812 c2809c00 03f98150 10be10e0 0a1ef20c 08a64028 0280f800 1de08200 00601001 c04c00a0 18828a70 37802041 8d78041c 10040400 c0002002 64088271 18040871 04004305 0146040e c03c0840 420006a8 | 0450a002 00200808 60084109 40050200 00041000 04004004 80080400 01a40000 02004100 28000840 00002124 4014a800 46808c0c 08010002 01030022 020c000c 00024000 02002800 04200208 10028000 40240000 08048b20 30820000 00c89204 20002c40 a0082380 04040210 08000040 00004281 00020000 c0105140 15020000 |