On Target PLP_SARS 0.36548224/CHEMBL358279
For the given ligand MOLECULE 25, we have found in our database that, being scored 0.36548224, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| MOLECULE 25 (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| COC(=O)NC(C(=O)N1CCCC1c8ncc(c7ccc(c6ccc(c5ccc(c4cnc(C2CCCN2C(=O)C(NC(=O)OC)c3ccccc3)[nH]4)cc5)cc6)cc7)[nH]8)c9ccccc9 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 0000a00a 01803800 00100d00 94010e10 00000040 0011001a 01400000 22083049 00800380 000808d0 08218000 4001b800 0b008882 08102000 40020000 801e010c 00028000 06002022 04000018 50000a01 80200000 38278e10 31002001 8350001c 00140001 80080002 00000208 900010e0 0c014304 00e60803 e00468a0 20002600 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |