On Target RT_HIV1 0.2781955/CHEMBL4227382
For the given ligand Chloroquine, we have found in our database that, being scored 0.2781955, the most similar ligand is CHEMBL4227382. Check out the elaboration below.
| Chloroquine (Given Ligand) | CHEMBL4227382 (Similar Ligand) |
|---|---|
| CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 | C=C(C)[C@@H]1CC[C@]2(CNCCCN(C)c3ccccc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 0001c002 01000000 00104000 00000600 200c0000 00002000 08008000 20000000 00200000 000008c0 00200004 40038800 02000806 00400000 00020040 00040004 00040000 00000000 08200000 00000201 40100000 18048108 20800000 80100010 00006000 00000000 00008000 10000080 00008000 00060000 00040000 00420240 | 00004002 01000c00 00100302 40050600 20000000 00004000 80000080 20000402 00000900 001809e0 08300004 40018800 00028002 00200000 00020442 00080008 00040400 02000020 0a012000 00000201 61100100 18020a30 20008020 00500014 01200000 80000000 00406000 d0000080 00408002 01060012 e4020000 00002600 |