On Target NA_INFB 0.24855492/CHEMBL4175983
For the given ligand Chloroquine, we have found in our database that, being scored 0.24855492, the most similar ligand is CHEMBL4175983. Check out the elaboration below.
| Chloroquine (Given Ligand) | CHEMBL4175983 (Similar Ligand) |
|---|---|
| CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N3CCCC3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 0001c002 01000000 00104000 00000600 200c0000 00002000 08008000 20000000 00200000 000008c0 00200004 40038800 02000806 00400000 00020040 00040004 00040000 00000000 08200000 00000201 40100000 18048108 20800000 80100010 00006000 00000000 00008000 10000080 00008000 00060000 00040000 00420240 | 00074042 09007800 00100100 84010700 20180080 00002810 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00021448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |