On Target PLP_SARS 0.2616279/CHEMBL365134
For the given ligand Chloroquine, we have found in our database that, being scored 0.2616279, the most similar ligand is CHEMBL365134. Check out the elaboration below.
| Chloroquine (Given Ligand) | CHEMBL365134 (Similar Ligand) |
|---|---|
| CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 | O=C1C(=O)N(Cc2cc3ccccc3s2)c2c(Br)cccc21 |
|
|
|
|
|
|
| 0001c002 01000000 00104000 00000600 200c0000 00002000 08008000 20000000 00200000 000008c0 00200004 40038800 02000806 00400000 00020040 00040004 00040000 00000000 08200000 00000201 40100000 18048108 20800000 80100010 00006000 00000000 00008000 10000080 00008000 00060000 00040000 00420240 | 1001c002 15c08800 02100100 00010600 300c8000 00010040 00000080 02085002 44810080 000808c0 08280204 c001f080 03008812 00100020 c00225c0 00000000 00049000 0200000c 08204000 00000209 c0101400 58228689 20012080 8144001d 02000022 c4010282 00020010 80001084 05088300 00062003 a0047008 28c10600 |