On Target ACE2_HUMAN 0.2556391/CHEMBL252003
For the given ligand curcumin, we have found in our database that, being scored 0.2556391, the most similar ligand is CHEMBL252003. Check out the elaboration below.
| curcumin (Given Ligand) | CHEMBL252003 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(Oc2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00010000 43005008 20100108 00110600 00001080 c0000000 82000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 20040000 81080001 00080008 10000000 02000000 00482008 00020201 00400100 18200e00 03000140 85500018 00000800 80000000 00000000 10200040 04000280 00060003 20004400 03012600 |