On Target NS5B_HCV1B 0.16460906/CHEMBL3645198
For the given ligand curcumin, we have found in our database that, being scored 0.16460906, the most similar ligand is CHEMBL3645198. Check out the elaboration below.
| curcumin (Given Ligand) | CHEMBL3645198 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3cccc(OC)c3F)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00004086 4480de08 2018090a 43310e00 210c1000 00004052 02040000 02001408 00100900 004909e0 09312024 40118800 80008c73 01401201 818a4441 200e200e 06268a00 02000004 08680008 00225203 e0100101 3c8b8e38 2080c800 b364801c 02104080 c0000048 00270080 8000108d 0c488304 0046805b e4048088 a81147e0 |