On Target PR_SARS 0.22891566/CHEMBL471187
For the given ligand curcumin, we have found in our database that, being scored 0.22891566, the most similar ligand is CHEMBL471187. Check out the elaboration below.
| curcumin (Given Ligand) | CHEMBL471187 (Similar Ligand) |
|---|---|
| COc2cc(/C=C/C(=O)CC(=O)/C=C/c1ccc(O)c(OC)c1)ccc2O | Oc1cc(O)cc(Oc2c(O)cc(O)c3c2Oc2c(O)cc(O)cc2O3)c1 |
|
|
|
|
|
|
| 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 | 00000001 00000008 20000008 00000200 00001000 00000000 42000000 00000000 00100000 00000840 00000000 00008800 00004002 00000000 01000001 00008008 00000000 00000004 00002000 00020800 00400000 08000100 00000000 00000000 00000000 20000000 00080000 00200000 80000200 00020008 00000400 02000000 |