On Target ACE2_HUMAN 0.1986755/CHEMBL401397
For the given ligand MOLECULE 20, we have found in our database that, being scored 0.1986755, the most similar ligand is CHEMBL401397. Check out the elaboration below.
| MOLECULE 20 (Given Ligand) | CHEMBL401397 (Similar Ligand) |
|---|---|
| Nc2c(S(=O)(=O)O)cc1cc(S(=O)(=O)O)ccc1c2/N=N/c6ccc(c5ccc(/N=N/c3c(N)c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)ccc34)c(S(=O)(=O)O)c5)cc6S(=O)(=O)O | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(-c2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 00002002 00800800 40000100 00d10200 00005300 00030000 00000000 00000200 00001a00 00080840 00002004 60008010 00000000 08200002 802603d0 00000000 00028100 02804404 44000000 00002000 c0000001 08120008 30000012 09582008 00014000 81000000 80100410 50000040 00104000 00060001 02800000 00010020 | 00012000 01005000 00100100 00110600 00001081 00000000 80000000 20000004 00000880 020a08c0 08300000 4001b000 06008002 00040000 80080000 00080008 10020000 02001000 04400008 00000201 00000100 18200e00 13000140 85500018 00000800 80000080 00000000 10000041 04004000 00060003 20004000 03012600 |