On Target PA_INFA 0.16030534/CHEMBL1829211
For the given ligand MOLECULE 20, we have found in our database that, being scored 0.16030534, the most similar ligand is CHEMBL1829211. Check out the elaboration below.
| MOLECULE 20 (Given Ligand) | CHEMBL1829211 (Similar Ligand) |
|---|---|
| Nc2c(S(=O)(=O)O)cc1cc(S(=O)(=O)O)ccc1c2/N=N/c6ccc(c5ccc(/N=N/c3c(N)c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)ccc34)c(S(=O)(=O)O)c5)cc6S(=O)(=O)O | O=C(O)/C(O)=C/C(=O)c1ccc(-c2ccccc2)cc1 |
|
|
|
|
|
|
| 00002002 00800800 40000100 00d10200 00005300 00030000 00000000 00000200 00001a00 00080840 00002004 60008010 00000000 08200002 802603d0 00000000 00028100 02804404 44000000 00002000 c0000001 08120008 30000012 09582008 00014000 81000000 80100410 50000040 00104000 00060001 02800000 00010020 | 00002000 00000800 00000100 40010200 00000000 00800000 00000001 00000400 01000100 00980840 08000000 4000c800 80008000 00000000 00000000 00080008 00020400 02100000 04250010 10000800 00000000 18020a80 14008000 00400014 00001000 84004400 00400000 00000040 00004000 00020002 84000000 00000400 |