On Target NS5B_HCV1B 0.31142858/CHEMBL3645204
For the given ligand MOLECULE 78, we have found in our database that, being scored 0.31142858, the most similar ligand is CHEMBL3645204. Check out the elaboration below.
| MOLECULE 78 (Given Ligand) | CHEMBL3645204 (Similar Ligand) |
|---|---|
| O=C(OCC7OC(n5c(=O)n(c1ccccc1)c(=O)c4c(c2ccco2)cc(c3ccccc3)nc45)C(OC(=O)c6ccccc6)C7OC(=O)c8ccccc8)c9ccccc9 | CNC(=O)c1c2cc(C3CC3)c(N(CCC3COC(C)(C)OC3)S(C)(=O)=O)cc2nn1-c1ccc(Cl)cc1 |
|
|
|
|
|
|
| 0000a002 01e00a00 8008470c 92050700 003c00f0 0200e140 00009e42 00a81440 06506102 d18008f0 0c00182c 60118812 c2809c00 03f98150 10be10e0 0a1ef20c 08a64028 0280f800 1de08200 00601001 c04c00a0 18828a70 37802041 8d78041c 10040400 c0002002 64088271 18040871 04004305 0146040e c03c0840 420006a8 | 0000c006 04805e08 20180902 41310f00 211c0040 00006042 02840800 02001408 00300900 014908e0 09312024 40118800 82008c27 01400201 804a0040 002e300e 04268000 02000604 09608008 00224201 c0100121 1c838f38 21800800 9360001c 02106480 c0000040 002f0280 b400108c 0c488304 0046004b c4248080 a0134ff0 |