On Target PR_SARS 0.15254237/CHEMBL2441741
For the given ligand MOLECULE 20, we have found in our database that, being scored 0.15254237, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| MOLECULE 20 (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| Nc2c(S(=O)(=O)O)cc1cc(S(=O)(=O)O)ccc1c2/N=N/c6ccc(c5ccc(/N=N/c3c(N)c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)ccc34)c(S(=O)(=O)O)c5)cc6S(=O)(=O)O | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00002002 00800800 40000100 00d10200 00005300 00030000 00000000 00000200 00001a00 00080840 00002004 60008010 00000000 08200002 802603d0 00000000 00028100 02804404 44000000 00002000 c0000001 08120008 30000012 09582008 00014000 81000000 80100410 50000040 00104000 00060001 02800000 00010020 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |