On Target NP_HCoV-OC43 0.15925926/CHEMBL3233481
For the given ligand MOLECULE 78, we have found in our database that, being scored 0.15925926, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| MOLECULE 78 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| O=C(OCC7OC(n5c(=O)n(c1ccccc1)c(=O)c4c(c2ccco2)cc(c3ccccc3)nc45)C(OC(=O)c6ccccc6)C7OC(=O)c8ccccc8)c9ccccc9 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0000a002 01e00a00 8008470c 92050700 003c00f0 0200e140 00009e42 00a81440 06506102 d18008f0 0c00182c 60118812 c2809c00 03f98150 10be10e0 0a1ef20c 08a64028 0280f800 1de08200 00601001 c04c00a0 18828a70 37802041 8d78041c 10040400 c0002002 64088271 18040871 04004305 0146040e c03c0840 420006a8 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |