On Target NP_HCoV-OC43 0.13138686/CHEMBL3233481
For the given ligand MOLECULE 20, we have found in our database that, being scored 0.13138686, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| MOLECULE 20 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Nc2c(S(=O)(=O)O)cc1cc(S(=O)(=O)O)ccc1c2/N=N/c6ccc(c5ccc(/N=N/c3c(N)c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)ccc34)c(S(=O)(=O)O)c5)cc6S(=O)(=O)O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00002002 00800800 40000100 00d10200 00005300 00030000 00000000 00000200 00001a00 00080840 00002004 60008010 00000000 08200002 802603d0 00000000 00028100 02804404 44000000 00002000 c0000001 08120008 30000012 09582008 00014000 81000000 80100410 50000040 00104000 00060001 02800000 00010020 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |