On Target PR_HIV1 0.084848486/CHEMBL3645129
For the given ligand aspirine, we have found in our database that, being scored 0.084848486, the most similar ligand is CHEMBL3645129. Check out the elaboration below.
| aspirine (Given Ligand) | CHEMBL3645129 (Similar Ligand) |
|---|---|
| ON1C/[O+]=I\C1 | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1CC2OCO[C@@H]2C1)S(=O)(=O)c1ccc(CO)cc1 |
|
|
|
|
|
|
| 00404000 00000015 00000000 00000000 00000000 00000000 00000000 00001000 00000200 00000080 00200000 00010000 00000004 02000000 00000000 00100018 00000000 00000000 00000000 00005002 00000000 00000020 00000000 04000010 00000000 00000000 00000000 00140000 00000000 00440000 00200001 00000000 | 00000010 01c05400 01100102 01b10700 00280088 0002c004 00000800 a8000004 00740b00 014809e0 08302000 60018000 00008002 02200101 80e80000 003a0008 10822000 02080000 11408800 01007603 80000100 18380cb0 07100040 d9500058 02000000 8000100e 00000000 3420002c 04000600 2106001b c0a00000 00012670 |