On Target RT_HIV1 0.075187966/CHEMBL4278516
For the given ligand aspirine, we have found in our database that, being scored 0.075187966, the most similar ligand is CHEMBL4278516. Check out the elaboration below.
| aspirine (Given Ligand) | CHEMBL4278516 (Similar Ligand) |
|---|---|
| ON1C/[O+]=I\C1 | O=c1[nH]c(Sc2ccc(Br)cc2)c(I)c(=O)n1O |
|
|
|
|
|
|
| 00404000 00000015 00000000 00000000 00000000 00000000 00000000 00001000 00000200 00000080 00200000 00010000 00000004 02000000 00000000 00100018 00000000 00000000 00000000 00005002 00000000 00000020 00000000 04000010 00000000 00000000 00000000 00140000 00000000 00440000 00200001 00000000 | 01004002 40c08200 60020420 02180600 00040000 00004000 00010002 40001000 06000100 00000861 04000004 3000a000 00008a12 024000c0 00200000 000c0014 04001048 00018000 80600110 00001004 90882080 4c028010 20800840 40980019 00050000 c8000000 60020010 00840000 00084a00 01460000 40200018 080120e0 |