On Target NSP15_SARS 0.24242425/CHEMBL2441741
For the given ligand Tanshinol, we have found in our database that, being scored 0.24242425, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Tanshinol (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| O=C(O)C(O)Cc1ccc(O)c(O)c1 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00000000 42000008 20000100 00010200 00000041 40000000 02000000 00000000 00000800 00080840 08100000 4000d000 04008002 00000000 00040000 00088008 08000000 02000000 00400008 00020201 00000100 08000a00 05000040 00400010 00000800 80000000 00120000 00000000 00000000 00020002 00000000 00000400 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |