On Target NS3_HCV1A 0.27799228/CHEMBL3951818
For the given ligand Quercetin, we have found in our database that, being scored 0.27799228, the most similar ligand is CHEMBL3951818. Check out the elaboration below.
| Quercetin (Given Ligand) | CHEMBL3951818 (Similar Ligand) |
|---|---|
| O=c2c(O)c(c1ccc(O)c(O)c1)oc3cc(O)cc(O)c23 | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S(C)(=O)=O)c(-c3ccc4c(c3)-c3cc5ccccc5n3CO4)cc12 |
|
|
|
|
|
|
| 00402001 40200018 20080100 00110200 0001020c 80004020 02000000 40800200 020a4100 40000840 00000090 41008000 40008412 00200088 00000020 0000a208 00064040 02000840 0e000200 00821a00 00240000 08000828 10000000 00584000 08400000 80000000 140a00b4 08100040 00006000 01820800 41000240 00000000 | 08416002 00200809 2018090a 52310602 0a841221 0200c110 02250400 62a83200 04474140 500008d0 8424a124 40118400 c0808c13 00601081 e12a5861 2216200c 00264000 02033804 0e200200 14524222 403e0008 3a068e3e f0880020 8058c004 0800008c c0014002 34420214 988010cd 0040e304 11068441 c0140a40 00010260 |