On Target NS3_HCV1A 0.3291536/CHEMBL3951314
For the given ligand Hyperoside, we have found in our database that, being scored 0.3291536, the most similar ligand is CHEMBL3951314. Check out the elaboration below.
| Hyperoside (Given Ligand) | CHEMBL3951314 (Similar Ligand) |
|---|---|
| O=c3c(OC1OC(CO)C(O)C(O)C1O)c(c2ccc(O)c(O)c2)oc4cc(O)cc(O)c34 | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S(C)(=O)=O)c(-c3ccc4c(c3)-c3cc5ccccc5n3CC(NC3CCN(C)CC3)CO4)cc12 |
|
|
|
|
|
|
| 0c402001 41200018 20080108 01110300 803d124c 82004820 03042800 40802200 022a4110 41000860 40000090 41008010 40808412 02a00088 11200021 002ab208 00864040 22008840 1f48a200 00825a03 00340020 08000c28 15000000 0a584010 08400400 80000000 140a00b4 2c900068 01006300 11820a01 41e00240 02b50008 | 0c416002 01200c09 2018090a 52310602 2a8412a1 0200e110 02250000 42a83200 00674100 108009e0 8420a124 50118400 c0808c13 00601081 e12a5861 220e200c 10264000 2203b804 0ea00200 10524223 403e0008 3a068e3e f3880021 8258c014 0800008c c0004000 34420214 988010cd 0844e304 11068451 c0040e40 00010260 |