On Target NS3_HCV1A 0.2792208/CHEMBL4110238
For the given ligand Rosmarinic acid, we have found in our database that, being scored 0.2792208, the most similar ligand is CHEMBL4110238. Check out the elaboration below.
| Rosmarinic acid (Given Ligand) | CHEMBL4110238 (Similar Ligand) |
|---|---|
| O=C(/C=C/c1ccc(O)c(O)c1)OC(Cc2ccc(O)c(O)c2)C(=O)O | CC[C@@H](N[C@H](C)CC(N)=O)c1ccc(OC)c(C(=O)c2ccccc2)c1F |
|
|
|
|
|
|
| 00040000 42000008 20000500 00010200 00000041 40000000 82000080 00000440 01800800 00080840 48100000 4010d080 0c008002 00000000 00040002 00088008 08020400 82000000 24418018 00020201 00010120 08000a00 05000041 08400014 00001c00 80000000 00522000 40000420 00400200 00020102 04000000 02000410 | 000000c0 00000c08 20100108 02010600 00001201 00020010 12040000 03001200 00000800 00088fc0 08300000 40009200 0c008842 00001000 01000401 08082008 03000200 02000000 00000410 00020201 00000100 18028600 01000000 32400014 00001000 e0000000 08320800 c0800001 00000380 00068012 a2040010 00002600 |