On Target ACE2_HUMAN 0.20588236/CHEMBL254495
For the given ligand Hyperoside, we have found in our database that, being scored 0.20588236, the most similar ligand is CHEMBL254495. Check out the elaboration below.
| Hyperoside (Given Ligand) | CHEMBL254495 (Similar Ligand) |
|---|---|
| O=c3c(OC1OC(CO)C(O)C(O)C1O)c(c2ccc(O)c(O)c2)oc4cc(O)cc(O)c34 | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(OCc2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 0c402001 41200018 20080108 01110300 803d124c 82004820 03042800 40802200 022a4110 41000860 40000090 41008010 40808412 02a00088 11200021 002ab208 00864040 22008840 1f48a200 00825a03 00340020 08000c28 15000000 0a584010 08400400 80000000 140a00b4 2c900068 01006300 11820a01 41e00240 02b50008 | 04010000 43005008 20100108 00110600 00001080 c0004000 82000000 20000004 00000980 020a08c0 08300000 4001b000 06808002 20050080 81080001 02080008 10000000 02000000 00480008 00020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00000000 10000040 04000200 00060003 60004000 03012600 |