On Target NS3_HCV1B 0.13725491/CHEMBL297884
For the given ligand Luteolin, we have found in our database that, being scored 0.13725491, the most similar ligand is CHEMBL297884. Check out the elaboration below.
| Luteolin (Given Ligand) | CHEMBL297884 (Similar Ligand) |
|---|---|
| O=c2cc(c1ccc(O)c(O)c1)oc3cc(O)cc(O)c23 | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@H]5/C=C\CCCCC[C@H](NC(=O)OC5CCCC5)C(=O)N4C3)cc(-c3csc(NC(C)C)n3)nc2c1 |
|
|
|
|
|
|
| 00402001 40200018 20080100 00110200 00000200 80004020 02000000 40800200 02084100 40000840 00000010 41008000 40008412 00200088 00000020 00008208 00064040 02000840 0e000200 00821a00 00240000 08000828 10000000 00580000 08000000 80000000 040200b4 08100040 00006000 01820800 40000040 00000000 | 04072002 c9427008 a0104908 14810702 211c10a0 02118050 c6080100 b00a848a 10800300 2010c8ca 00202a04 5101b420 0e82881a 01502183 911a3441 021e200c 10a24000 120861c4 44e82818 12e63a01 40080000 3914aef8 f390c883 82510018 00a01081 8c101002 00e04240 90200465 0c00420c 850e2403 e4065800 04252a42 |