On Target PA_INFA 0.22950819/CHEMBL2443239
For the given ligand Quercetin, we have found in our database that, being scored 0.22950819, the most similar ligand is CHEMBL2443239. Check out the elaboration below.
| Quercetin (Given Ligand) | CHEMBL2443239 (Similar Ligand) |
|---|---|
| O=c2c(O)c(c1ccc(O)c(O)c1)oc3cc(O)cc(O)c23 | O=c1[nH]c(-c2ccc(F)cc2)c(-c2ccc(-c3nnn[nH]3)cc2)cc1O |
|
|
|
|
|
|
| 00402001 40200018 20080100 00110200 0001020c 80004020 02000000 40800200 020a4100 40000840 00000090 41008000 40008412 00200088 00000020 0000a208 00064040 02000840 0e000200 00821a00 00240000 08000828 10000000 00584000 08400000 80000000 140a00b4 08100040 00006000 01820800 41000240 00000000 | 00002002 40000019 60104100 12010210 01841028 0400005c 00800800 00280000 06000100 50000860 04008084 40008000 00018894 00201001 20120000 820c200c 00020060 02002804 04200000 10721002 40060120 88008000 3080c000 00504400 00042403 c0280000 18020240 00000041 00404004 00028400 80000a00 08000200 |