On Target PR_HIV1 0.12785389/CHEMBL510485
For the given ligand Quercetin, we have found in our database that, being scored 0.12785389, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| Quercetin (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| O=c2c(O)c(c1ccc(O)c(O)c1)oc3cc(O)cc(O)c23 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 00402001 40200018 20080100 00110200 0001020c 80004020 02000000 40800200 020a4100 40000840 00000090 41008000 40008412 00200088 00000020 0000a208 00064040 02000840 0e000200 00821a00 00240000 08000828 10000000 00584000 08400000 80000000 140a00b4 08100040 00006000 01820800 41000240 00000000 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |