On Target PR_HIV1 0.15/CHEMBL510485
For the given ligand protocatechuic acid, we have found in our database that, being scored 0.15, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| protocatechuic acid (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| O=C(O)c1ccc(O)c(O)c1 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 00000000 48000808 20000101 00010200 00000000 00004000 02000000 00000000 00000100 00000840 00000000 40008000 00008002 00000000 00000000 20088008 00000000 02000000 00000000 00020200 00000000 08020a20 00000000 00400004 00000000 80000000 00420000 00000000 00000000 00020000 c0000000 00000000 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |