On Target RT_HIV1 0.2857143/CHEMBL4228598
For the given ligand protocatechuic acid, we have found in our database that, being scored 0.2857143, the most similar ligand is CHEMBL4228598. Check out the elaboration below.
| protocatechuic acid (Given Ligand) | CHEMBL4228598 (Similar Ligand) |
|---|---|
| O=C(O)c1ccc(O)c(O)c1 | C=C(C)[C@@H]1CC[C@]2(CNCCCN)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000000 48000808 20000101 00010200 00000000 00004000 02000000 00000000 00000100 00000840 00000000 40008000 00008002 00000000 00000000 20088008 00000000 02000000 00000000 00020200 00000000 08020a20 00000000 00400004 00000000 80000000 00420000 00000000 00000000 00020000 c0000000 00000000 | 00000000 01000c00 00100302 40050600 00000000 00004000 80000080 20000402 00000900 001809c0 08300000 40018800 00028002 00200000 00000402 00080008 00000400 02000020 02012000 00000201 01000100 18020a30 00008020 00500014 01200000 80000000 00406000 d0000000 00400002 01060012 e4020000 00002600 |