On Target NS5B_HCV1B 0.16117217/CHEMBL3645188
For the given ligand Quercetin, we have found in our database that, being scored 0.16117217, the most similar ligand is CHEMBL3645188. Check out the elaboration below.
| Quercetin (Given Ligand) | CHEMBL3645188 (Similar Ligand) |
|---|---|
| O=c2c(O)c(c1ccc(O)c(O)c1)oc3cc(O)cc(O)c23 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3ccoc3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00402001 40200018 20080100 00110200 0001020c 80004020 02000000 40800200 020a4100 40000840 00000090 41008000 40008412 00200088 00000020 0000a208 00064040 02000840 0e000200 00821a00 00240000 08000828 10000000 00584000 08400000 80000000 140a00b4 08100040 00006000 01820800 41000240 00000000 | 00004006 00a0de08 20180902 41310e00 210c0001 00004042 02050000 02201418 00124900 004909e0 0d312024 40118c00 c0008c33 01400201 c08a4440 200e200e 04268000 02030004 08600008 00225203 e0100101 1c8b8e3e 2080c800 9368001c 02104084 c0004048 00670090 8880108c 0c488104 0046005b e4048088 a81147e0 |