On Target NA_INFB 0.16083916/CHEMBL79499
For the given ligand protocatechuic acid, we have found in our database that, being scored 0.16083916, the most similar ligand is CHEMBL79499. Check out the elaboration below.
| protocatechuic acid (Given Ligand) | CHEMBL79499 (Similar Ligand) |
|---|---|
| O=C(O)c1ccc(O)c(O)c1 | CC[C@H](CCc1ccccc1)O[C@@H]1C=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00000000 48000808 20000101 00010200 00000000 00004000 02000000 00000000 00000100 00000840 00000000 40008000 00008002 00000000 00000000 20088008 00000000 02000000 00000000 00020200 00000000 08020a20 00000000 00400004 00000000 80000000 00420000 00000000 00000000 00020000 c0000000 00000000 | 00070040 09007008 00100102 80010700 00180080 00000800 02080180 38000402 11000800 001808c8 48300000 41019001 0402801a 01a80000 00001408 00081008 10a04000 02000060 60c12010 00000201 00000120 38040e80 13008040 02500018 10001400 80001400 00c04000 90000001 0c000202 00060403 04020000 00000610 |