On Target RDRP_SARS2 0.13607594/CHEMBL4065616
For the given ligand Quercetin, we have found in our database that, being scored 0.13607594, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| Quercetin (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| O=c2c(O)c(c1ccc(O)c(O)c1)oc3cc(O)cc(O)c23 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 00402001 40200018 20080100 00110200 0001020c 80004020 02000000 40800200 020a4100 40000840 00000090 41008000 40008412 00200088 00000020 0000a208 00064040 02000840 0e000200 00821a00 00240000 08000828 10000000 00584000 08400000 80000000 140a00b4 08100040 00006000 01820800 41000240 00000000 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |