On Target PLP_SARS 0.252809/CHEMBL426898
For the given ligand Quercetin, we have found in our database that, being scored 0.252809, the most similar ligand is CHEMBL426898. Check out the elaboration below.
| Quercetin (Given Ligand) | CHEMBL426898 (Similar Ligand) |
|---|---|
| O=c2c(O)c(c1ccc(O)c(O)c1)oc3cc(O)cc(O)c23 | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2o1 |
|
|
|
|
|
|
| 00402001 40200018 20080100 00110200 0001020c 80004020 02000000 40800200 020a4100 40000840 00000090 41008000 40008412 00200088 00000020 0000a208 00064040 02000840 0e000200 00821a00 00240000 08000828 10000000 00584000 08400000 80000000 140a00b4 08100040 00006000 01820800 41000240 00000000 | 04108002 00200808 60084109 00010200 00041200 04004004 80080000 41200200 02004100 20000840 00000124 4004a800 46808c0c 08010082 01030022 020c000c 00024000 02002000 00200008 00020000 40000000 08068b28 30800000 00c89204 28002c40 a0082380 04000214 08000000 00002281 01020000 c0005000 10020000 |