On Target NS3_HCV1A 0.30033004/CHEMBL3913576
For the given ligand Galuteolin, we have found in our database that, being scored 0.30033004, the most similar ligand is CHEMBL3913576. Check out the elaboration below.
| Galuteolin (Given Ligand) | CHEMBL3913576 (Similar Ligand) |
|---|---|
| O=c3cc(c1ccc(O)c(O)c1)oc4cc(O)cc(OC2OC(CO)C(O)C(O)C2O)c34 | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S(C)(=O)=O)c(-c3ccc4c(c3)-c3nc5ccccc5n3CO4)cc12 |
|
|
|
|
|
|
| 04402041 41200018 28080108 00110300 80281240 82004820 42002800 40800200 02284100 41000860 40000010 41008000 40808412 02a00088 11200021 002ab208 00864040 02000840 1f48a200 00821a01 00340020 08000828 15200000 0a580010 08000400 80000000 040200b5 2c900060 51056200 01820800 40a00040 00010000 | 08416002 00200809 2018090a 52310602 0a841261 0200c110 02250c00 62a83200 04474140 510018f0 8524a12c 40118400 c0009c13 00601081 e12a5861 221e200c 00264020 02033800 1e600200 14d25220 c03e0008 3a068e3e f1880021 02588004 0800008c c0014002 24420214 988010cd 0040e304 01468c01 c0140840 000102e0 |