On Target PA_INFA 0.37894738/CHEMBL573638
For the given ligand Ethyl ferulate, we have found in our database that, being scored 0.37894738, the most similar ligand is CHEMBL573638. Check out the elaboration below.
| Ethyl ferulate (Given Ligand) | CHEMBL573638 (Similar Ligand) |
|---|---|
| CCOC(=O)/C=C/c1ccc(O)c(OC)c1 | O=C(O)/C(O)=C/C(=O)c1ccc(Oc2ccccc2)cc1 |
|
|
|
|
|
|
| 00000000 40000008 20000108 00010200 00001000 00000000 82000080 00000400 01800000 00000840 40000000 40108000 0400c002 00000000 01000003 00088008 00020400 02000000 20098018 00020200 00000000 08000a00 00000001 00400000 00001400 80000000 00422000 40000400 00400200 00020100 04000000 00000110 | 00000000 00000808 20000109 00010200 00001000 00800000 02040001 00000400 01000000 00980840 08000000 4000c000 80008002 00000000 01000001 00080008 00000400 02100000 00252010 00020800 00400000 18020a80 04008000 00400014 00001000 84004400 00520000 00200000 00004200 00020002 84000400 00000400 |