On Target NS5B_HCV1B 0.23255815/CHEMBL3970609
For the given ligand Galuteolin, we have found in our database that, being scored 0.23255815, the most similar ligand is CHEMBL3970609. Check out the elaboration below.
| Galuteolin (Given Ligand) | CHEMBL3970609 (Similar Ligand) |
|---|---|
| O=c3cc(c1ccc(O)c(O)c1)oc4cc(O)cc(OC2OC(CO)C(O)C(O)C2O)c34 | CO[C@]1(c2ccc3c(N)ncnn23)O[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@]1(C)C#N |
|
|
|
|
|
|
| 04402041 41200018 28080108 00110300 80281240 82004820 42002800 40800200 02284100 41000860 40000010 41008000 40808412 02a00088 11200021 002ab208 00864040 02000840 1f48a200 00821a01 00340020 08000828 15200000 0a580010 08000400 80000000 040200b5 2c900060 51056200 01820800 40a00040 00010000 | 0000080a 81004009 e2401512 19010f20 052c8074 0012c024 0381e800 00200a80 1060cb00 010c0060 08108004 4a839040 00000802 02b30020 000e0040 022cba0c 09cb8820 0680000e 1160a008 00665203 40100121 2c008860 a5801cc6 08600110 40000400 80002102 160880c0 a40508a0 0040020e 00c6cc16 41600280 6220ac82 |