On Target RDRP_SARS2 0.18023255/CHEMBL4065616
For the given ligand Cryptotanshinone, we have found in our database that, being scored 0.18023255, the most similar ligand is CHEMBL4065616. Check out the elaboration below.
| Cryptotanshinone (Given Ligand) | CHEMBL4065616 (Similar Ligand) |
|---|---|
| CC1COc3c1c(=O)c(=O)c4c2CCCC(C)(C)c2ccc34 | CCC(COC(=O)[C@@H](NP(=O)(Oc1ccccc1)OC[C@H]1O[C@@]([C@@H]([C@@H]1O)O)(C#N)c1ccc2n1ncnc2N)C)CC |
|
|
|
|
|
|
| 100d0000 01000800 01400302 00150301 22080011 0000c402 801001c0 10000401 05800940 00180a42 28102200 40009800 85028020 00a10000 42000026 0a08100a 00800604 02000100 0045e000 40000001 01500520 48020360 0100c020 00440014 01000400 88002301 00483008 c0806080 00404243 00220002 c6002024 02010400 | 0020004a 81144109 f2103512 99010f60 452c80f4 8008c004 0303c401 00200a20 19404b00 010c0844 08189004 4ac7b168 00009802 02b30020 000e9040 028eba8c 084b8830 06800005 21662008 00665243 60120120 3e008a60 a7801cc6 08700110 10000400 80002000 0f0892c0 900388a0 0240128f 00c6cc36 55400280 22339c84 |