On Target PLP_SARS 0.239819/CHEMBL426898
For the given ligand Galuteolin, we have found in our database that, being scored 0.239819, the most similar ligand is CHEMBL426898. Check out the elaboration below.
| Galuteolin (Given Ligand) | CHEMBL426898 (Similar Ligand) |
|---|---|
| O=c3cc(c1ccc(O)c(O)c1)oc4cc(O)cc(OC2OC(CO)C(O)C(O)C2O)c34 | O=C(Oc1cncc(Cl)c1)c1cc2ccccc2o1 |
|
|
|
|
|
|
| 04402041 41200018 28080108 00110300 80281240 82004820 42002800 40800200 02284100 41000860 40000010 41008000 40808412 02a00088 11200021 002ab208 00864040 02000840 1f48a200 00821a01 00340020 08000828 15200000 0a580010 08000400 80000000 040200b5 2c900060 51056200 01820800 40a00040 00010000 | 04108002 00200808 60084109 00010200 00041200 04004004 80080000 41200200 02004100 20000840 00000124 4004a800 46808c0c 08010082 01030022 020c000c 00024000 02002000 00200008 00020000 40000000 08068b28 30800000 00c89204 28002c40 a0082380 04000214 08000000 00002281 01020000 c0005000 10020000 |