On Target NS3_HCV1A 0.3129771/CHEMBL4106826
For the given ligand Butylidenephthalide, we have found in our database that, being scored 0.3129771, the most similar ligand is CHEMBL4106826. Check out the elaboration below.
| Butylidenephthalide (Given Ligand) | CHEMBL4106826 (Similar Ligand) |
|---|---|
| CCCC=c1oc(=O)c2ccccc12 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccc(COC(C)=O)cc2)c1F |
|
|
|
|
|
|
| 00280000 00010800 00000300 00010201 02000011 0800d000 80000080 00000400 00000100 40100840 08000000 40008800 80028000 00210000 02000002 02080008 00020400 02000200 00044000 00200001 00100000 08020b20 00208020 80400014 01000400 80002000 00483001 c0000000 00404200 00020000 c4000000 00000000 | 00008040 00000800 00100100 42050600 00000211 00004010 20000000 01001000 00000900 00080e40 08100000 40008a00 02008864 00011004 00000000 0a080008 03020200 03000000 00000400 00000001 00000500 18028b20 01000000 10400014 00002400 a0002200 080c0000 40800081 00000280 00068002 c4040000 00020600 |