On Target NS3_HCV1A 0.26956522/CHEMBL3908585
For the given ligand Apigenin, we have found in our database that, being scored 0.26956522, the most similar ligand is CHEMBL3908585. Check out the elaboration below.
| Apigenin (Given Ligand) | CHEMBL3908585 (Similar Ligand) |
|---|---|
| O=c2cc(c1ccc(O)cc1)oc3cc(O)cc(O)c23 | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(C)S(C)(=O)=O)c(-c3ccc4ccn5c6ccc(O)nc6cc5c4n3)cc12 |
|
|
|
|
|
|
| 00402001 00200018 20080100 00010200 00000200 80004020 02000000 40800200 02084100 40000840 00000010 41008000 40008412 00200088 00000020 00000208 00064000 02000840 0e000200 00820a00 00240000 08000028 10000000 00580000 08000000 80000000 040200b4 08100040 00006000 01820800 40000040 00000000 | 08402002 02a00819 20184902 52310e02 0a8c0261 0000c110 06218010 42a83200 10474100 10000840 0421a124 40308400 c0008c07 00e01081 e02e4b60 2206000c 08064000 12032800 0e600200 10524020 402e0000 3a028e2e 71800060 80480004 0800208c 80004000 04408054 888010cd 0040e104 01068c01 c0040a40 04010660 |