On Target ACE2_HUMAN 0.23870967/CHEMBL254703
For the given ligand Benzoylpaeoniflorin, we have found in our database that, being scored 0.23870967, the most similar ligand is CHEMBL254703. Check out the elaboration below.
| Benzoylpaeoniflorin (Given Ligand) | CHEMBL254703 (Similar Ligand) |
|---|---|
| CC14CC3(O)OC(O1)C5(COC(=O)c2ccccc2)C3CC45OC7OC(COC(=O)c6ccccc6)C(O)C(O)C7O | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)O |
|
|
|
|
|
|
| 00000040 01000800 80000508 00810300 80280050 00004000 00802800 08000040 00202100 010008e0 00040000 40018000 00008000 02810010 00080000 022a9008 00820000 02000000 1340a000 00000001 00100020 18020a30 05000000 08400014 00000400 80002000 00080000 24000020 00000200 0002000a c0a20000 02000000 | 04010000 01005008 20100108 00110600 00001080 00004000 82040000 20000004 00000980 020a08c0 08300000 4001b000 06808002 00050000 81080001 02080008 10000000 02000000 00400008 00020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00120000 10000040 04000200 00060003 60004000 03012600 |