On Target NS5B_HCV1A 0.23664123/CHEMBL367415
For the given ligand Butylidenephthalide, we have found in our database that, being scored 0.23664123, the most similar ligand is CHEMBL367415. Check out the elaboration below.
| Butylidenephthalide (Given Ligand) | CHEMBL367415 (Similar Ligand) |
|---|---|
| CCCC=c1oc(=O)c2ccccc12 | N#Cc1c(Cl)cccc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00280000 00010800 00000300 00010201 02000011 0800d000 80000080 00000400 00000100 40100840 08000000 40008800 80028000 00210000 02000002 02080008 00020400 02000200 00044000 00200001 00100000 08020b20 00208020 80400014 01000400 80002000 00483001 c0000000 00404200 00020000 c4000000 00000000 | 0005a000 01000801 00000102 00810200 00080021 00000000 04000000 00000000 04100900 00880840 08100000 4001d800 06008004 00200008 a0000000 08082008 00420000 02001000 04c00008 00002001 00000100 08020b00 11000480 00400014 00002800 80000280 00000000 00000041 10004002 00020402 80000000 00420400 |