On Target NS5B_HCV1A 0.16783217/CHEMBL175894
For the given ligand Apigenin, we have found in our database that, being scored 0.16783217, the most similar ligand is CHEMBL175894. Check out the elaboration below.
| Apigenin (Given Ligand) | CHEMBL175894 (Similar Ligand) |
|---|---|
| O=c2cc(c1ccc(O)cc1)oc3cc(O)cc(O)c23 | N#Cc1ccc(Br)cc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00402001 00200018 20080100 00010200 00000200 80004020 02000000 40800200 02084100 40000840 00000010 41008000 40008412 00200088 00000020 00000208 00064000 02000840 0e000200 00820a00 00240000 08000028 10000000 00580000 08000000 80000000 040200b4 08100040 00006000 01820800 40000040 00000000 | 00056000 01008801 00000102 00010200 00080021 00000000 00000000 00000000 54100900 00880840 08100008 c001d000 04008010 00200000 20000000 08082008 00420000 02001000 04c00008 00008001 00000100 08020a00 11000480 00400014 00000800 80000080 00120000 00000041 10004002 00060402 80000008 08400400 |