On Target NA_INFB 0.3529412/CHEMBL183817
For the given ligand Albiflorin, we have found in our database that, being scored 0.3529412, the most similar ligand is CHEMBL183817. Check out the elaboration below.
| Albiflorin (Given Ligand) | CHEMBL183817 (Similar Ligand) |
|---|---|
| CC15CC(O)C3CC1(OC2OC(CO)C(O)C(O)C2O)C3(COC(=O)c4ccccc4)C(=O)O5 | COC(=O)[C@@H]1C[C@H](C(=O)O)O[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00050040 01000800 00000508 00810300 803c0050 00204000 00002800 08000040 00202100 01000860 00040000 40009000 14008028 02810010 00080000 022a9008 00820000 02000000 1340a000 00000001 00100020 18020a20 05000000 08400014 00000400 80002000 00088000 24000020 00000200 0002000a c0a20000 02000000 | 00070040 01005000 00100000 80010500 003c00c0 00200000 00000000 20000000 00000000 01020080 00200000 4001d000 1400802a 03800000 00081008 18099008 10820000 80000100 11402000 00000201 00000020 10040e10 17000000 0810001c 10000400 00000000 00800200 10000021 00000200 00040001 00020000 00800a00 |