On Target NA_INFB 0.20618556/CHEMBL348066
For the given ligand Butylidenephthalide, we have found in our database that, being scored 0.20618556, the most similar ligand is CHEMBL348066. Check out the elaboration below.
| Butylidenephthalide (Given Ligand) | CHEMBL348066 (Similar Ligand) |
|---|---|
| CCCC=c1oc(=O)c2ccccc12 | CCCN(CCc1ccccc1)C(=O)[C@@H]1OC(C(=O)O)=C[C@H](N)[C@H]1NC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00280000 00010800 00000300 00010201 02000011 0800d000 80000080 00000400 00000100 40100840 08000000 40008800 80028000 00210000 02000002 02080008 00020400 02000200 00044000 00200001 00100000 08020b20 00208020 80400014 01000400 80002000 00483001 c0000000 00404200 00020000 c4000000 00000000 | 00030000 89007600 00100101 80010701 00000081 000003c0 00080180 38800c04 01200080 801889e8 88200000 4003d200 8c028002 00480000 02081408 38099008 30200004 82000141 40c14010 00002205 00004020 382a0f80 17008000 8b70001c 00001400 80000c00 00c04000 90000121 0c004200 00060413 0c040000 00006600 |