On Target NA_INFB 0.21167883/CHEMBL113191
For the given ligand Caffeic acid, we have found in our database that, being scored 0.21167883, the most similar ligand is CHEMBL113191. Check out the elaboration below.
| Caffeic acid (Given Ligand) | CHEMBL113191 (Similar Ligand) |
|---|---|
| O=C(O)/C=C\c1ccc(O)c(O)c1 | CC(=O)N[C@@H]1[C@@H](N)CC(C(=O)O)=C[C@H]1N(C)CCc1ccccc1 |
|
|
|
|
|
|
| 00000000 40000008 20000100 00010200 00000000 00000000 82000080 00000400 01800000 00000840 00000000 40108000 04008002 00000000 00000002 00088008 00000400 02000000 00018018 00020200 00000000 08000a00 00000001 00400000 00001000 80000000 00422000 40000000 00400000 00020100 04000000 00000000 | 00030010 0900b400 00100100 04010600 00180000 00000000 00180180 3800040a 11000080 001809c8 08200000 41019000 0402811a 01812000 00000400 00080308 20004000 02000160 40412010 00000201 00000000 38240f90 01008001 83500018 00001000 88008c00 00484000 90000000 0c000000 00060413 04020000 02002600 |