On Target NSP15_SARS 0.20125785/CHEMBL2441741
For the given ligand Butylidenephthalide, we have found in our database that, being scored 0.20125785, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Butylidenephthalide (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| CCCC=c1oc(=O)c2ccccc12 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00280000 00010800 00000300 00010201 02000011 0800d000 80000080 00000400 00000100 40100840 08000000 40008800 80028000 00210000 02000002 02080008 00020400 02000200 00044000 00200001 00100000 08020b20 00208020 80400014 01000400 80002000 00483001 c0000000 00404200 00020000 c4000000 00000000 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |