On Target PLP_SARS 0.28313252/CHEMBL213054
For the given ligand Albiflorin, we have found in our database that, being scored 0.28313252, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Albiflorin (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CC15CC(O)C3CC1(OC2OC(CO)C(O)C(O)C2O)C3(COC(=O)c4ccccc4)C(=O)O5 | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00050040 01000800 00000508 00810300 803c0050 00204000 00002800 08000040 00202100 01000860 00040000 40009000 14008028 02810010 00080000 022a9008 00820000 02000000 1340a000 00000001 00100020 18020a20 05000000 08400014 00000400 80002000 00088000 24000020 00000200 0002000a c0a20000 02000000 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |