On Target PLP_SARS 0.2536232/CHEMBL222735
For the given ligand Butylidenephthalide, we have found in our database that, being scored 0.2536232, the most similar ligand is CHEMBL222735. Check out the elaboration below.
| Butylidenephthalide (Given Ligand) | CHEMBL222735 (Similar Ligand) |
|---|---|
| CCCC=c1oc(=O)c2ccccc12 | COc1cccc(C(=O)Oc2cncc(Cl)c2)c1 |
|
|
|
|
|
|
| 00280000 00010800 00000300 00010201 02000011 0800d000 80000080 00000400 00000100 40100840 08000000 40008800 80028000 00210000 02000002 02080008 00020400 02000200 00044000 00200001 00100000 08020b20 00208020 80400014 01000400 80002000 00483001 c0000000 00404200 00020000 c4000000 00000000 | 04008002 48000808 60004108 00010200 00041000 04004004 82080000 01200000 00000100 00000848 00000004 40048800 0680880e 08010002 01034007 220c000c 00020000 02002000 00280008 00020200 40000000 08028b20 30800000 00c09004 00002c00 80082200 00000200 00000000 00000200 00020000 c0000000 10020000 |